About (Z)-4-(butylamino)-4-oxobut-2-enoate;butylazanium
(Z)-4-(butylamino)-4-oxobut-2-enoate;butylazanium (PubChem CID 155723677) has the molecular formula C12H24N2O3
and a molecular weight of 244.33 g/mol. Its IUPAC name is (Z)-4-(butylamino)-4-oxobut-2-enoate;butylazanium.
Molecular Properties
| Compound Name | (Z)-4-(butylamino)-4-oxobut-2-enoate;butylazanium |
| PubChem CID | 155723677 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | (Z)-4-(butylamino)-4-oxobut-2-enoate;butylazanium |
| SMILES | CCCCNC(=O)/C=C\C(=O)[O-].CCCC[NH3+] |
| InChI | InChI=1S/C8H13NO3.C4H11N/c1-2-3-6-9-7(10)4-5-8(11)12;1-2-3-4-5/h4-5H,2-3,6H2,1H3,(H,9,10)(H,11,12);2-5H2,1H3/b5-4-; |
| InChIKey | MEKXFYQZXJPVRP-MKWAYWHRSA-N |
| XLogP | -0.76 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-(butylamino)-4-oxobut-2-enoate;butylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-(butylamino)-4-oxobut-2-enoate;butylazanium?
The IUPAC name of (Z)-4-(butylamino)-4-oxobut-2-enoate;butylazanium (CID 155723677) is (Z)-4-(butylamino)-4-oxobut-2-enoate;butylazanium.
What is the SMILES notation for (Z)-4-(butylamino)-4-oxobut-2-enoate;butylazanium?
The canonical SMILES for (Z)-4-(butylamino)-4-oxobut-2-enoate;butylazanium is CCCCNC(=O)/C=C\C(=O)[O-].CCCC[NH3+].
What is the InChIKey of (Z)-4-(butylamino)-4-oxobut-2-enoate;butylazanium?
The InChIKey is MEKXFYQZXJPVRP-MKWAYWHRSA-N. The full InChI is InChI=1S/C8H13NO3.C4H11N/c1-2-3-6-9-7(10)4-5-8(11)12;1-2-3-4-5/h4-5H,2-3,6H2,1H3,(H,9,10)(H,11,12);2-5H2,1H3/b5-4-;.
What are the key properties of (Z)-4-(butylamino)-4-oxobut-2-enoate;butylazanium?
(Z)-4-(butylamino)-4-oxobut-2-enoate;butylazanium has a molecular weight of 244.33 g/mol, XLogP of -0.76, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-(butylamino)-4-oxobut-2-enoate;butylazanium is sourced from PubChem (CID 155723677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).