About octylazanium;carbonate
octylazanium;carbonate (PubChem CID 141329834) has the molecular formula C17H40N2O3
and a molecular weight of 320.52 g/mol. Its IUPAC name is octylazanium;carbonate.
Molecular Properties
| Compound Name | octylazanium;carbonate |
| PubChem CID | 141329834 |
| Molecular Formula | C17H40N2O3 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.30 |
| IUPAC Name | octylazanium;carbonate |
| SMILES | CCCCCCCC[NH3+].CCCCCCCC[NH3+].O=C([O-])[O-] |
| InChI | InChI=1S/2C8H19N.CH2O3/c2*1-2-3-4-5-6-7-8-9;2-1(3)4/h2*2-9H2,1H3;(H2,2,3,4) |
| InChIKey | GMEHDJZCRAANSP-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 118.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octylazanium;carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octylazanium;carbonate?
The IUPAC name of octylazanium;carbonate (CID 141329834) is octylazanium;carbonate.
What is the SMILES notation for octylazanium;carbonate?
The canonical SMILES for octylazanium;carbonate is CCCCCCCC[NH3+].CCCCCCCC[NH3+].O=C([O-])[O-].
What is the InChIKey of octylazanium;carbonate?
The InChIKey is GMEHDJZCRAANSP-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H19N.CH2O3/c2*1-2-3-4-5-6-7-8-9;2-1(3)4/h2*2-9H2,1H3;(H2,2,3,4).
What are the key properties of octylazanium;carbonate?
octylazanium;carbonate has a molecular weight of 320.52 g/mol, XLogP of 0.73, 12 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for octylazanium;carbonate is sourced from PubChem (CID 141329834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).