About dodecylazanium;octadecanoate
dodecylazanium;octadecanoate (PubChem CID 21217555) has the molecular formula C30H63NO2
and a molecular weight of 469.84 g/mol. Its IUPAC name is dodecylazanium;octadecanoate.
Molecular Properties
| Compound Name | dodecylazanium;octadecanoate |
| PubChem CID | 21217555 |
| Molecular Formula | C30H63NO2 |
| Molecular Weight | 469.84 g/mol |
| Exact Mass | 469.49 |
| IUPAC Name | dodecylazanium;octadecanoate |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)[O-].CCCCCCCCCCCC[NH3+] |
| InChI | InChI=1S/C18H36O2.C12H27N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-3-4-5-6-7-8-9-10-11-12-13/h2-17H2,1H3,(H,19,20);2-13H2,1H3 |
| InChIKey | HWGUOODPQIXVKG-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.84 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dodecylazanium;octadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodecylazanium;octadecanoate?
The IUPAC name of dodecylazanium;octadecanoate (CID 21217555) is dodecylazanium;octadecanoate.
What is the SMILES notation for dodecylazanium;octadecanoate?
The canonical SMILES for dodecylazanium;octadecanoate is CCCCCCCCCCCCCCCCCC(=O)[O-].CCCCCCCCCCCC[NH3+].
What is the InChIKey of dodecylazanium;octadecanoate?
The InChIKey is HWGUOODPQIXVKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O2.C12H27N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-3-4-5-6-7-8-9-10-11-12-13/h2-17H2,1H3,(H,19,20);2-13H2,1H3.
What are the key properties of dodecylazanium;octadecanoate?
dodecylazanium;octadecanoate has a molecular weight of 469.84 g/mol, XLogP of 8.15, 26 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dodecylazanium;octadecanoate is sourced from PubChem (CID 21217555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).