About docosanoate;bis(3-hydroxypropylazanium);chloride
docosanoate;bis(3-hydroxypropylazanium);chloride (PubChem CID 155619144) has the molecular formula C28H63ClN2O4
and a molecular weight of 527.28 g/mol. Its IUPAC name is docosanoate;bis(3-hydroxypropylazanium);chloride.
Molecular Properties
| Compound Name | docosanoate;bis(3-hydroxypropylazanium);chloride |
| PubChem CID | 155619144 |
| Molecular Formula | C28H63ClN2O4 |
| Molecular Weight | 527.28 g/mol |
| Exact Mass | 526.45 |
| IUPAC Name | docosanoate;bis(3-hydroxypropylazanium);chloride |
| SMILES | CCCCCCCCCCCCCCCCCCCCCC(=O)[O-].[Cl-].[NH3+]CCCO.[NH3+]CCCO |
| InChI | InChI=1S/C22H44O2.2C3H9NO.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24;2*4-2-1-3-5;/h2-21H2,1H3,(H,23,24);2*5H,1-4H2;1H |
| InChIKey | QKCUOGYNOMRMCE-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 527.28 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze docosanoate;bis(3-hydroxypropylazanium);chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of docosanoate;bis(3-hydroxypropylazanium);chloride?
The IUPAC name of docosanoate;bis(3-hydroxypropylazanium);chloride (CID 155619144) is docosanoate;bis(3-hydroxypropylazanium);chloride.
What is the SMILES notation for docosanoate;bis(3-hydroxypropylazanium);chloride?
The canonical SMILES for docosanoate;bis(3-hydroxypropylazanium);chloride is CCCCCCCCCCCCCCCCCCCCCC(=O)[O-].[Cl-].[NH3+]CCCO.[NH3+]CCCO.
What is the InChIKey of docosanoate;bis(3-hydroxypropylazanium);chloride?
The InChIKey is QKCUOGYNOMRMCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H44O2.2C3H9NO.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24;2*4-2-1-3-5;/h2-21H2,1H3,(H,23,24);2*5H,1-4H2;1H.
What are the key properties of docosanoate;bis(3-hydroxypropylazanium);chloride?
docosanoate;bis(3-hydroxypropylazanium);chloride has a molecular weight of 527.28 g/mol, XLogP of 0.78, 24 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for docosanoate;bis(3-hydroxypropylazanium);chloride is sourced from PubChem (CID 155619144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).