C30H21F14P — CID 141042722
2,2-dimethyloctyl-(1,3,4,5,6,7,8,9,10-nonafluoroanthracen-2-yl)-(2,3,4,5,6-pentafluorophenyl)phosphane (PubChem CID 141042722) has the molecular formula C30H21F14P and a molecular weight of 678.44 g/mol. Its IUPAC name is 2,2-dimethyloctyl-(1,3,4,5,6,7,8,9,10-nonafluoroanthracen-2-yl)-(2,3,4,5,6-pentafluorophenyl)phosphane.
| Compound Name | 2,2-dimethyloctyl-(1,3,4,5,6,7,8,9,10-nonafluoroanthracen-2-yl)-(2,3,4,5,6-pentafluorophenyl)phosphane |
|---|---|
| PubChem CID | 141042722 |
| Molecular Formula | C30H21F14P |
| Molecular Weight | 678.44 g/mol |
| Exact Mass | 678.12 |
| IUPAC Name | 2,2-dimethyloctyl-(1,3,4,5,6,7,8,9,10-nonafluoroanthracen-2-yl)-(2,3,4,5,6-pentafluorophenyl)phosphane |
| SMILES | CCCCCCC(C)(C)CP(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c2c(F)c3c(F)c(F)c(F)c(F)c3c(F)c2c1F |
| InChI | InChI=1S/C30H21F14P/c1-4-5-6-7-8-30(2,3)9-45(29-26(43)23(40)22(39)24(41)27(29)44)28-19(36)13-12(18(35)25(28)42)14(31)10-11(15(13)32)17(34)21(38)20(37)16(10)33/h4-9H2,1-3H3 |
| InChIKey | PNAHKJUEFAFKAU-UHFFFAOYSA-N |
| XLogP | 10.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.44 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|