C32H60BF4N — CID 22637978
butyl-methyl-(2,3,4,6-tetrafluoro-5-methylphenyl)azanium;tetrapentylboranuide (PubChem CID 22637978) has the molecular formula C32H60BF4N and a molecular weight of 545.64 g/mol. Its IUPAC name is butyl-methyl-(2,3,4,6-tetrafluoro-5-methylphenyl)azanium;tetrapentylboranuide.
| Compound Name | butyl-methyl-(2,3,4,6-tetrafluoro-5-methylphenyl)azanium;tetrapentylboranuide |
|---|---|
| PubChem CID | 22637978 |
| Molecular Formula | C32H60BF4N |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.48 |
| IUPAC Name | butyl-methyl-(2,3,4,6-tetrafluoro-5-methylphenyl)azanium;tetrapentylboranuide |
| SMILES | CCCCC[B-](CCCCC)(CCCCC)CCCCC.CCCC[NH+](C)c1c(F)c(C)c(F)c(F)c1F |
| InChI | InChI=1S/C20H44B.C12H15F4N/c1-5-9-13-17-21(18-14-10-6-2,19-15-11-7-3)20-16-12-8-4;1-4-5-6-17(3)12-9(14)7(2)8(13)10(15)11(12)16/h5-20H2,1-4H3;4-6H2,1-3H3/q-1;/p+1 |
| InChIKey | RBFNLNPIMBKNSA-UHFFFAOYSA-O |
| XLogP | 10.69 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|