C43H79BF5N — CID 18388719
1-(2,3,4,5,6-pentafluorophenyl)piperidin-1-ium;tetraoctylboranuide (PubChem CID 18388719) has the molecular formula C43H79BF5N and a molecular weight of 715.91 g/mol. Its IUPAC name is 1-(2,3,4,5,6-pentafluorophenyl)piperidin-1-ium;tetraoctylboranuide.
| Compound Name | 1-(2,3,4,5,6-pentafluorophenyl)piperidin-1-ium;tetraoctylboranuide |
|---|---|
| PubChem CID | 18388719 |
| Molecular Formula | C43H79BF5N |
| Molecular Weight | 715.91 g/mol |
| Exact Mass | 715.62 |
| IUPAC Name | 1-(2,3,4,5,6-pentafluorophenyl)piperidin-1-ium;tetraoctylboranuide |
| SMILES | CCCCCCCC[B-](CCCCCCCC)(CCCCCCCC)CCCCCCCC.Fc1c(F)c(F)c([NH+]2CCCCC2)c(F)c1F |
| InChI | InChI=1S/C32H68B.C11H10F5N/c1-5-9-13-17-21-25-29-33(30-26-22-18-14-10-6-2,31-27-23-19-15-11-7-3)32-28-24-20-16-12-8-4;12-6-7(13)9(15)11(10(16)8(6)14)17-4-2-1-3-5-17/h5-32H2,1-4H3;1-5H2/q-1;/p+1 |
| InChIKey | YPQRZAWZCBSHOH-UHFFFAOYSA-O |
| XLogP | 14.96 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 29 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.91 |
| LogP ≤ 5 | 14.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|