C45H86BF4N — CID 22638147
hexyl-methyl-(2,3,4,5-tetrafluorophenyl)azanium;tetraoctylboranuide (PubChem CID 22638147) has the molecular formula C45H86BF4N and a molecular weight of 727.99 g/mol. Its IUPAC name is hexyl-methyl-(2,3,4,5-tetrafluorophenyl)azanium;tetraoctylboranuide.
| Compound Name | hexyl-methyl-(2,3,4,5-tetrafluorophenyl)azanium;tetraoctylboranuide |
|---|---|
| PubChem CID | 22638147 |
| Molecular Formula | C45H86BF4N |
| Molecular Weight | 727.99 g/mol |
| Exact Mass | 727.68 |
| IUPAC Name | hexyl-methyl-(2,3,4,5-tetrafluorophenyl)azanium;tetraoctylboranuide |
| SMILES | CCCCCCCC[B-](CCCCCCCC)(CCCCCCCC)CCCCCCCC.CCCCCC[NH+](C)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C32H68B.C13H17F4N/c1-5-9-13-17-21-25-29-33(30-26-22-18-14-10-6-2,31-27-23-19-15-11-7-3)32-28-24-20-16-12-8-4;1-3-4-5-6-7-18(2)10-8-9(14)11(15)13(17)12(10)16/h5-32H2,1-4H3;8H,3-7H2,1-2H3/q-1;/p+1 |
| InChIKey | HPBIVIGHNLLCSF-UHFFFAOYSA-O |
| XLogP | 15.85 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 34 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.99 |
| LogP ≤ 5 | 15.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|