C57H29AlF29N — CID 22637886
nonyl-(1,1,2,2,2-pentafluoroethyl)-phenylazanium;tetrakis(2,3,4,5,6,7-hexafluoronaphthalen-1-yl)alumanuide (PubChem CID 22637886) has the molecular formula C57H29AlF29N and a molecular weight of 1305.79 g/mol. Its IUPAC name is nonyl-(1,1,2,2,2-pentafluoroethyl)-phenylazanium;tetrakis(2,3,4,5,6,7-hexafluoronaphthalen-1-yl)alumanuide.
| Compound Name | nonyl-(1,1,2,2,2-pentafluoroethyl)-phenylazanium;tetrakis(2,3,4,5,6,7-hexafluoronaphthalen-1-yl)alumanuide |
|---|---|
| PubChem CID | 22637886 |
| Molecular Formula | C57H29AlF29N |
| Molecular Weight | 1305.79 g/mol |
| Exact Mass | 1305.17 |
| IUPAC Name | nonyl-(1,1,2,2,2-pentafluoroethyl)-phenylazanium;tetrakis(2,3,4,5,6,7-hexafluoronaphthalen-1-yl)alumanuide |
| SMILES | CCCCCCCCC[NH+](c1ccccc1)C(F)(F)C(F)(F)F.Fc1cc2c([Al-](c3c(F)c(F)c(F)c4c(F)c(F)c(F)cc34)(c3c(F)c(F)c(F)c4c(F)c(F)c(F)cc34)c3c(F)c(F)c(F)c4c(F)c(F)c(F)cc34)c(F)c(F)c(F)c2c(F)c1F |
| InChI | InChI=1S/C17H24F5N.4C10HF6.Al/c1-2-3-4-5-6-7-11-14-23(15-12-9-8-10-13-15)17(21,22)16(18,19)20;4*11-4-1-3-2-5(12)8(14)10(16)6(3)9(15)7(4)13;/h8-10,12-13H,2-7,11,14H2,1H3;4*1H;/q;;;;;-1/p+1 |
| InChIKey | VBWQBUGFWMMCHW-UHFFFAOYSA-O |
| XLogP | 16.12 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 88 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1305.79 |
| LogP ≤ 5 | 16.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|