C14H17F7P+ — CID 23123698
(2,5-difluorophenyl)-(2-methylpentyl)-(1,1,2,2,2-pentafluoroethyl)phosphanium (PubChem CID 23123698) has the molecular formula C14H17F7P+ and a molecular weight of 349.25 g/mol. Its IUPAC name is (2,5-difluorophenyl)-(2-methylpentyl)-(1,1,2,2,2-pentafluoroethyl)phosphanium.
| Compound Name | (2,5-difluorophenyl)-(2-methylpentyl)-(1,1,2,2,2-pentafluoroethyl)phosphanium |
|---|---|
| PubChem CID | 23123698 |
| Molecular Formula | C14H17F7P+ |
| Molecular Weight | 349.25 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | (2,5-difluorophenyl)-(2-methylpentyl)-(1,1,2,2,2-pentafluoroethyl)phosphanium |
| SMILES | CCCC(C)C[PH+](c1cc(F)ccc1F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H16F7P/c1-3-4-9(2)8-22(14(20,21)13(17,18)19)12-7-10(15)5-6-11(12)16/h5-7,9H,3-4,8H2,1-2H3/p+1 |
| InChIKey | ASMHALZDXAWVQZ-UHFFFAOYSA-O |
| XLogP | 5.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.25 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|