C13H18F2O — CID 63901618
1-(2,5-difluorophenyl)-3-methylhexan-2-ol (PubChem CID 63901618) has the molecular formula C13H18F2O and a molecular weight of 228.28 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-3-methylhexan-2-ol.
| Compound Name | 1-(2,5-difluorophenyl)-3-methylhexan-2-ol |
|---|---|
| PubChem CID | 63901618 |
| Molecular Formula | C13H18F2O |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 1-(2,5-difluorophenyl)-3-methylhexan-2-ol |
| SMILES | CCCC(C)C(O)Cc1cc(F)ccc1F |
| InChI | InChI=1S/C13H18F2O/c1-3-4-9(2)13(16)8-10-7-11(14)5-6-12(10)15/h5-7,9,13,16H,3-4,8H2,1-2H3 |
| InChIKey | DZCRUBOZMQHVOG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |