C13H18F2OS — CID 65136744
1-butan-2-ylsulfanyl-3-(2,5-difluorophenyl)propan-2-ol (PubChem CID 65136744) has the molecular formula C13H18F2OS and a molecular weight of 260.35 g/mol. Its IUPAC name is 1-butan-2-ylsulfanyl-3-(2,5-difluorophenyl)propan-2-ol.
| Compound Name | 1-butan-2-ylsulfanyl-3-(2,5-difluorophenyl)propan-2-ol |
|---|---|
| PubChem CID | 65136744 |
| Molecular Formula | C13H18F2OS |
| Molecular Weight | 260.35 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 1-butan-2-ylsulfanyl-3-(2,5-difluorophenyl)propan-2-ol |
| SMILES | CCC(C)SCC(O)Cc1cc(F)ccc1F |
| InChI | InChI=1S/C13H18F2OS/c1-3-9(2)17-8-12(16)7-10-6-11(14)4-5-13(10)15/h4-6,9,12,16H,3,7-8H2,1-2H3 |
| InChIKey | RWJRMBRBNGAEGL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |