C13H18BrClOS — CID 113471219
1-(4-bromo-2-chlorophenyl)-3-butan-2-ylsulfanylpropan-2-ol (PubChem CID 113471219) has the molecular formula C13H18BrClOS and a molecular weight of 337.71 g/mol. Its IUPAC name is 1-(4-bromo-2-chlorophenyl)-3-butan-2-ylsulfanylpropan-2-ol.
| Compound Name | 1-(4-bromo-2-chlorophenyl)-3-butan-2-ylsulfanylpropan-2-ol |
|---|---|
| PubChem CID | 113471219 |
| Molecular Formula | C13H18BrClOS |
| Molecular Weight | 337.71 g/mol |
| Exact Mass | 336.00 |
| IUPAC Name | 1-(4-bromo-2-chlorophenyl)-3-butan-2-ylsulfanylpropan-2-ol |
| SMILES | CCC(C)SCC(O)Cc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C13H18BrClOS/c1-3-9(2)17-8-12(16)6-10-4-5-11(14)7-13(10)15/h4-5,7,9,12,16H,3,6,8H2,1-2H3 |
| InChIKey | BRJTXLCYHNBCJI-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.71 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |