C14H20BrClO — CID 114270641
1-(4-bromo-2-chlorophenyl)-3,4,4-trimethylpentan-2-ol (PubChem CID 114270641) has the molecular formula C14H20BrClO and a molecular weight of 319.67 g/mol. Its IUPAC name is 1-(4-bromo-2-chlorophenyl)-3,4,4-trimethylpentan-2-ol.
| Compound Name | 1-(4-bromo-2-chlorophenyl)-3,4,4-trimethylpentan-2-ol |
|---|---|
| PubChem CID | 114270641 |
| Molecular Formula | C14H20BrClO |
| Molecular Weight | 319.67 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 1-(4-bromo-2-chlorophenyl)-3,4,4-trimethylpentan-2-ol |
| SMILES | CC(C(O)Cc1ccc(Br)cc1Cl)C(C)(C)C |
| InChI | InChI=1S/C14H20BrClO/c1-9(14(2,3)4)13(17)7-10-5-6-11(15)8-12(10)16/h5-6,8-9,13,17H,7H2,1-4H3 |
| InChIKey | NCIFZSACEJVHFH-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.67 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |