C16H22BrClO2 — CID 116756312
3-(4-bromo-2-chlorophenyl)-1-cyclohexyl-1-methoxypropan-2-ol (PubChem CID 116756312) has the molecular formula C16H22BrClO2 and a molecular weight of 361.71 g/mol. Its IUPAC name is 3-(4-bromo-2-chlorophenyl)-1-cyclohexyl-1-methoxypropan-2-ol.
| Compound Name | 3-(4-bromo-2-chlorophenyl)-1-cyclohexyl-1-methoxypropan-2-ol |
|---|---|
| PubChem CID | 116756312 |
| Molecular Formula | C16H22BrClO2 |
| Molecular Weight | 361.71 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 3-(4-bromo-2-chlorophenyl)-1-cyclohexyl-1-methoxypropan-2-ol |
| SMILES | COC(C(O)Cc1ccc(Br)cc1Cl)C1CCCCC1 |
| InChI | InChI=1S/C16H22BrClO2/c1-20-16(11-5-3-2-4-6-11)15(19)9-12-7-8-13(17)10-14(12)18/h7-8,10-11,15-16,19H,2-6,9H2,1H3 |
| InChIKey | KJUSJZGZLHLLRA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.71 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |