C14H21BrClNS — CID 113471272
1-(4-bromo-2-chlorophenyl)-3-butan-2-ylsulfanyl-N-methylpropan-2-amine (PubChem CID 113471272) has the molecular formula C14H21BrClNS and a molecular weight of 350.75 g/mol. Its IUPAC name is 1-(4-bromo-2-chlorophenyl)-3-butan-2-ylsulfanyl-N-methylpropan-2-amine.
| Compound Name | 1-(4-bromo-2-chlorophenyl)-3-butan-2-ylsulfanyl-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 113471272 |
| Molecular Formula | C14H21BrClNS |
| Molecular Weight | 350.75 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 1-(4-bromo-2-chlorophenyl)-3-butan-2-ylsulfanyl-N-methylpropan-2-amine |
| SMILES | CCC(C)SCC(Cc1ccc(Br)cc1Cl)NC |
| InChI | InChI=1S/C14H21BrClNS/c1-4-10(2)18-9-13(17-3)7-11-5-6-12(15)8-14(11)16/h5-6,8,10,13,17H,4,7,9H2,1-3H3 |
| InChIKey | VEWNFMXUAJHQJD-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.75 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |