C13H18BrFOS — CID 65135215
1-(4-bromo-2-fluorophenyl)-3-(2-methylpropylsulfanyl)propan-2-ol (PubChem CID 65135215) has the molecular formula C13H18BrFOS and a molecular weight of 321.25 g/mol. Its IUPAC name is 1-(4-bromo-2-fluorophenyl)-3-(2-methylpropylsulfanyl)propan-2-ol.
| Compound Name | 1-(4-bromo-2-fluorophenyl)-3-(2-methylpropylsulfanyl)propan-2-ol |
|---|---|
| PubChem CID | 65135215 |
| Molecular Formula | C13H18BrFOS |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 1-(4-bromo-2-fluorophenyl)-3-(2-methylpropylsulfanyl)propan-2-ol |
| SMILES | CC(C)CSCC(O)Cc1ccc(Br)cc1F |
| InChI | InChI=1S/C13H18BrFOS/c1-9(2)7-17-8-12(16)5-10-3-4-11(14)6-13(10)15/h3-4,6,9,12,16H,5,7-8H2,1-2H3 |
| InChIKey | ZBKXYCSJSLGJSC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |