C12H16ClFOS — CID 114854652
1-(4-chloro-2-fluorophenyl)-3-propan-2-ylsulfanylpropan-2-ol (PubChem CID 114854652) has the molecular formula C12H16ClFOS and a molecular weight of 262.78 g/mol. Its IUPAC name is 1-(4-chloro-2-fluorophenyl)-3-propan-2-ylsulfanylpropan-2-ol.
| Compound Name | 1-(4-chloro-2-fluorophenyl)-3-propan-2-ylsulfanylpropan-2-ol |
|---|---|
| PubChem CID | 114854652 |
| Molecular Formula | C12H16ClFOS |
| Molecular Weight | 262.78 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 1-(4-chloro-2-fluorophenyl)-3-propan-2-ylsulfanylpropan-2-ol |
| SMILES | CC(C)SCC(O)Cc1ccc(Cl)cc1F |
| InChI | InChI=1S/C12H16ClFOS/c1-8(2)16-7-11(15)5-9-3-4-10(13)6-12(9)14/h3-4,6,8,11,15H,5,7H2,1-2H3 |
| InChIKey | RNNGKLNHYAHGGR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.78 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |