C12H16F2OS — CID 82920814
1-(3,4-difluorophenyl)-3-propan-2-ylsulfanylpropan-2-ol (PubChem CID 82920814) has the molecular formula C12H16F2OS and a molecular weight of 246.32 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-propan-2-ylsulfanylpropan-2-ol.
| Compound Name | 1-(3,4-difluorophenyl)-3-propan-2-ylsulfanylpropan-2-ol |
|---|---|
| PubChem CID | 82920814 |
| Molecular Formula | C12H16F2OS |
| Molecular Weight | 246.32 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-propan-2-ylsulfanylpropan-2-ol |
| SMILES | CC(C)SCC(O)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H16F2OS/c1-8(2)16-7-10(15)5-9-3-4-11(13)12(14)6-9/h3-4,6,8,10,15H,5,7H2,1-2H3 |
| InChIKey | QHLJGGRRRYUBLG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |