C11H14F2O2 — CID 103448967
1-(3,4-difluorophenyl)-3-methylbutane-2,3-diol (PubChem CID 103448967) has the molecular formula C11H14F2O2 and a molecular weight of 216.23 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-methylbutane-2,3-diol.
| Compound Name | 1-(3,4-difluorophenyl)-3-methylbutane-2,3-diol |
|---|---|
| PubChem CID | 103448967 |
| Molecular Formula | C11H14F2O2 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-methylbutane-2,3-diol |
| SMILES | CC(C)(O)C(O)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H14F2O2/c1-11(2,15)10(14)6-7-3-4-8(12)9(13)5-7/h3-5,10,14-15H,6H2,1-2H3 |
| InChIKey | OACLSYBBZFOHAD-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |