C9H7F2NO — CID 141475699
3-(3,4-difluorophenyl)-2-hydroxypropanenitrile (PubChem CID 141475699) has the molecular formula C9H7F2NO and a molecular weight of 183.16 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)-2-hydroxypropanenitrile.
| Compound Name | 3-(3,4-difluorophenyl)-2-hydroxypropanenitrile |
|---|---|
| PubChem CID | 141475699 |
| Molecular Formula | C9H7F2NO |
| Molecular Weight | 183.16 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 3-(3,4-difluorophenyl)-2-hydroxypropanenitrile |
| SMILES | N#CC(O)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C9H7F2NO/c10-8-2-1-6(4-9(8)11)3-7(13)5-12/h1-2,4,7,13H,3H2 |
| InChIKey | UAGNQDMHIOYIPI-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.16 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|