C10H9F2N — CID 104995733
1-(3,4-difluorophenyl)but-3-yn-2-amine (PubChem CID 104995733) has the molecular formula C10H9F2N and a molecular weight of 181.18 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)but-3-yn-2-amine.
| Compound Name | 1-(3,4-difluorophenyl)but-3-yn-2-amine |
|---|---|
| PubChem CID | 104995733 |
| Molecular Formula | C10H9F2N |
| Molecular Weight | 181.18 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 1-(3,4-difluorophenyl)but-3-yn-2-amine |
| SMILES | C#CC(N)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H9F2N/c1-2-8(13)5-7-3-4-9(11)10(12)6-7/h1,3-4,6,8H,5,13H2 |
| InChIKey | TWKFPIZKAAFCQO-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.18 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|