C15H13BrF3N — CID 115843232
1-(2-bromo-4-fluorophenyl)-3-(3,4-difluorophenyl)propan-2-amine (PubChem CID 115843232) has the molecular formula C15H13BrF3N and a molecular weight of 344.17 g/mol. Its IUPAC name is 1-(2-bromo-4-fluorophenyl)-3-(3,4-difluorophenyl)propan-2-amine.
| Compound Name | 1-(2-bromo-4-fluorophenyl)-3-(3,4-difluorophenyl)propan-2-amine |
|---|---|
| PubChem CID | 115843232 |
| Molecular Formula | C15H13BrF3N |
| Molecular Weight | 344.17 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | 1-(2-bromo-4-fluorophenyl)-3-(3,4-difluorophenyl)propan-2-amine |
| SMILES | NC(Cc1ccc(F)c(F)c1)Cc1ccc(F)cc1Br |
| InChI | InChI=1S/C15H13BrF3N/c16-13-8-11(17)3-2-10(13)7-12(20)5-9-1-4-14(18)15(19)6-9/h1-4,6,8,12H,5,7,20H2 |
| InChIKey | ISBRZVMAFWQRTL-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.17 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |