C11H11F2N — CID 176776859
1,2-difluoro-4-(2-isocyanobutyl)benzene (PubChem CID 176776859) has the molecular formula C11H11F2N and a molecular weight of 195.21 g/mol. Its IUPAC name is 1,2-difluoro-4-(2-isocyanobutyl)benzene.
| Compound Name | 1,2-difluoro-4-(2-isocyanobutyl)benzene |
|---|---|
| PubChem CID | 176776859 |
| Molecular Formula | C11H11F2N |
| Molecular Weight | 195.21 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 1,2-difluoro-4-(2-isocyanobutyl)benzene |
| SMILES | [C-]#[N+]C(CC)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H11F2N/c1-3-9(14-2)6-8-4-5-10(12)11(13)7-8/h4-5,7,9H,3,6H2,1H3 |
| InChIKey | JPQLLEGKIOXZRA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.21 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|