C17H19F2NO — CID 174454339
3-[3-(3,4-difluorophenyl)-2-(dimethylamino)propyl]phenol (PubChem CID 174454339) has the molecular formula C17H19F2NO and a molecular weight of 291.34 g/mol. Its IUPAC name is 3-[3-(3,4-difluorophenyl)-2-(dimethylamino)propyl]phenol.
| Compound Name | 3-[3-(3,4-difluorophenyl)-2-(dimethylamino)propyl]phenol |
|---|---|
| PubChem CID | 174454339 |
| Molecular Formula | C17H19F2NO |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 3-[3-(3,4-difluorophenyl)-2-(dimethylamino)propyl]phenol |
| SMILES | CN(C)C(Cc1cccc(O)c1)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H19F2NO/c1-20(2)14(8-12-4-3-5-15(21)10-12)9-13-6-7-16(18)17(19)11-13/h3-7,10-11,14,21H,8-9H2,1-2H3 |
| InChIKey | ZNSFSKWJSMFAQE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |