C13H15F2N — CID 104995812
1-(3,4-difluorophenyl)-N-propylbut-3-yn-2-amine (PubChem CID 104995812) has the molecular formula C13H15F2N and a molecular weight of 223.27 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-N-propylbut-3-yn-2-amine.
| Compound Name | 1-(3,4-difluorophenyl)-N-propylbut-3-yn-2-amine |
|---|---|
| PubChem CID | 104995812 |
| Molecular Formula | C13H15F2N |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 1-(3,4-difluorophenyl)-N-propylbut-3-yn-2-amine |
| SMILES | C#CC(Cc1ccc(F)c(F)c1)NCCC |
| InChI | InChI=1S/C13H15F2N/c1-3-7-16-11(4-2)8-10-5-6-12(14)13(15)9-10/h2,5-6,9,11,16H,3,7-8H2,1H3 |
| InChIKey | KDXXJNSGQPVHOE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|