C12H13F2N — CID 114977659
1-(3,4-difluorophenyl)-N-methylpent-4-yn-2-amine (PubChem CID 114977659) has the molecular formula C12H13F2N and a molecular weight of 209.24 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-N-methylpent-4-yn-2-amine.
| Compound Name | 1-(3,4-difluorophenyl)-N-methylpent-4-yn-2-amine |
|---|---|
| PubChem CID | 114977659 |
| Molecular Formula | C12H13F2N |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 1-(3,4-difluorophenyl)-N-methylpent-4-yn-2-amine |
| SMILES | C#CCC(Cc1ccc(F)c(F)c1)NC |
| InChI | InChI=1S/C12H13F2N/c1-3-4-10(15-2)7-9-5-6-11(13)12(14)8-9/h1,5-6,8,10,15H,4,7H2,2H3 |
| InChIKey | DWKATQZLJBNGGN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|