C12H15F2NO2 — CID 82351619
methyl 4-(3,4-difluorophenyl)-3-(methylamino)butanoate (PubChem CID 82351619) has the molecular formula C12H15F2NO2 and a molecular weight of 243.25 g/mol. Its IUPAC name is methyl 4-(3,4-difluorophenyl)-3-(methylamino)butanoate.
| Compound Name | methyl 4-(3,4-difluorophenyl)-3-(methylamino)butanoate |
|---|---|
| PubChem CID | 82351619 |
| Molecular Formula | C12H15F2NO2 |
| Molecular Weight | 243.25 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | methyl 4-(3,4-difluorophenyl)-3-(methylamino)butanoate |
| SMILES | CNC(CC(=O)OC)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H15F2NO2/c1-15-9(7-12(16)17-2)5-8-3-4-10(13)11(14)6-8/h3-4,6,9,15H,5,7H2,1-2H3 |
| InChIKey | CTLZKIMLBSIFKP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.25 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |