C13H18F2O2 — CID 103457159
1-(3,4-difluorophenyl)-4,4-dimethylpentane-2,3-diol (PubChem CID 103457159) has the molecular formula C13H18F2O2 and a molecular weight of 244.28 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-4,4-dimethylpentane-2,3-diol.
| Compound Name | 1-(3,4-difluorophenyl)-4,4-dimethylpentane-2,3-diol |
|---|---|
| PubChem CID | 103457159 |
| Molecular Formula | C13H18F2O2 |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 1-(3,4-difluorophenyl)-4,4-dimethylpentane-2,3-diol |
| SMILES | CC(C)(C)C(O)C(O)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H18F2O2/c1-13(2,3)12(17)11(16)7-8-4-5-9(14)10(15)6-8/h4-6,11-12,16-17H,7H2,1-3H3 |
| InChIKey | UJMWYECLODVPHV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |