C14H20F2O2 — CID 116713006
1-(3,4-difluorophenyl)-3-methoxy-4,4-dimethylpentan-2-ol (PubChem CID 116713006) has the molecular formula C14H20F2O2 and a molecular weight of 258.31 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-methoxy-4,4-dimethylpentan-2-ol.
| Compound Name | 1-(3,4-difluorophenyl)-3-methoxy-4,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 116713006 |
| Molecular Formula | C14H20F2O2 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-methoxy-4,4-dimethylpentan-2-ol |
| SMILES | COC(C(O)Cc1ccc(F)c(F)c1)C(C)(C)C |
| InChI | InChI=1S/C14H20F2O2/c1-14(2,3)13(18-4)12(17)8-9-5-6-10(15)11(16)7-9/h5-7,12-13,17H,8H2,1-4H3 |
| InChIKey | CKTRXHWSGRHEMX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |