C13H18ClFO2 — CID 114012679
1-(4-chloro-3-fluorophenyl)-3-ethylpentane-2,3-diol (PubChem CID 114012679) has the molecular formula C13H18ClFO2 and a molecular weight of 260.74 g/mol. Its IUPAC name is 1-(4-chloro-3-fluorophenyl)-3-ethylpentane-2,3-diol.
| Compound Name | 1-(4-chloro-3-fluorophenyl)-3-ethylpentane-2,3-diol |
|---|---|
| PubChem CID | 114012679 |
| Molecular Formula | C13H18ClFO2 |
| Molecular Weight | 260.74 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 1-(4-chloro-3-fluorophenyl)-3-ethylpentane-2,3-diol |
| SMILES | CCC(O)(CC)C(O)Cc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C13H18ClFO2/c1-3-13(17,4-2)12(16)8-9-5-6-10(14)11(15)7-9/h5-7,12,16-17H,3-4,8H2,1-2H3 |
| InChIKey | CCIBIBZRHQNODK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.74 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |