C15H22ClFO2 — CID 103039717
1-(3-chloro-4-fluorophenyl)-3-ethoxy-3-ethylpentan-2-ol (PubChem CID 103039717) has the molecular formula C15H22ClFO2 and a molecular weight of 288.79 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-ethoxy-3-ethylpentan-2-ol.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-ethoxy-3-ethylpentan-2-ol |
|---|---|
| PubChem CID | 103039717 |
| Molecular Formula | C15H22ClFO2 |
| Molecular Weight | 288.79 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-ethoxy-3-ethylpentan-2-ol |
| SMILES | CCOC(CC)(CC)C(O)Cc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C15H22ClFO2/c1-4-15(5-2,19-6-3)14(18)10-11-7-8-13(17)12(16)9-11/h7-9,14,18H,4-6,10H2,1-3H3 |
| InChIKey | DVBBXMRCZJJTKW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.79 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |