C15H21ClFNO — CID 103039633
1-(3-chloro-4-fluorophenyl)-3-methyl-3-pyrrolidin-1-ylbutan-2-ol (PubChem CID 103039633) has the molecular formula C15H21ClFNO and a molecular weight of 285.79 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-methyl-3-pyrrolidin-1-ylbutan-2-ol.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-methyl-3-pyrrolidin-1-ylbutan-2-ol |
|---|---|
| PubChem CID | 103039633 |
| Molecular Formula | C15H21ClFNO |
| Molecular Weight | 285.79 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-methyl-3-pyrrolidin-1-ylbutan-2-ol |
| SMILES | CC(C)(C(O)Cc1ccc(F)c(Cl)c1)N1CCCC1 |
| InChI | InChI=1S/C15H21ClFNO/c1-15(2,18-7-3-4-8-18)14(19)10-11-5-6-13(17)12(16)9-11/h5-6,9,14,19H,3-4,7-8,10H2,1-2H3 |
| InChIKey | OMZTUDHOZDSMQE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.79 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |