C15H21Cl2NO — CID 79056291
1-(2,5-dichlorophenyl)-3-methyl-3-pyrrolidin-1-ylbutan-2-ol (PubChem CID 79056291) has the molecular formula C15H21Cl2NO and a molecular weight of 302.24 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-3-methyl-3-pyrrolidin-1-ylbutan-2-ol.
| Compound Name | 1-(2,5-dichlorophenyl)-3-methyl-3-pyrrolidin-1-ylbutan-2-ol |
|---|---|
| PubChem CID | 79056291 |
| Molecular Formula | C15H21Cl2NO |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-3-methyl-3-pyrrolidin-1-ylbutan-2-ol |
| SMILES | CC(C)(C(O)Cc1cc(Cl)ccc1Cl)N1CCCC1 |
| InChI | InChI=1S/C15H21Cl2NO/c1-15(2,18-7-3-4-8-18)14(19)10-11-9-12(16)5-6-13(11)17/h5-6,9,14,19H,3-4,7-8,10H2,1-2H3 |
| InChIKey | JOKHNBZOGRBOFT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |