C14H20Cl2N2 — CID 79055718
1-(2,5-dichlorophenyl)-2-methyl-2-pyrrolidin-1-ylpropan-1-amine (PubChem CID 79055718) has the molecular formula C14H20Cl2N2 and a molecular weight of 287.23 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-2-methyl-2-pyrrolidin-1-ylpropan-1-amine.
| Compound Name | 1-(2,5-dichlorophenyl)-2-methyl-2-pyrrolidin-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 79055718 |
| Molecular Formula | C14H20Cl2N2 |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-2-methyl-2-pyrrolidin-1-ylpropan-1-amine |
| SMILES | CC(C)(C(N)c1cc(Cl)ccc1Cl)N1CCCC1 |
| InChI | InChI=1S/C14H20Cl2N2/c1-14(2,18-7-3-4-8-18)13(17)11-9-10(15)5-6-12(11)16/h5-6,9,13H,3-4,7-8,17H2,1-2H3 |
| InChIKey | WZOIYAGDMIAIGB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |