C12H14Cl2O — CID 65321223
1-cyclobutyl-2-(2,5-dichlorophenyl)ethanol (PubChem CID 65321223) has the molecular formula C12H14Cl2O and a molecular weight of 245.15 g/mol. Its IUPAC name is 1-cyclobutyl-2-(2,5-dichlorophenyl)ethanol.
| Compound Name | 1-cyclobutyl-2-(2,5-dichlorophenyl)ethanol |
|---|---|
| PubChem CID | 65321223 |
| Molecular Formula | C12H14Cl2O |
| Molecular Weight | 245.15 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 1-cyclobutyl-2-(2,5-dichlorophenyl)ethanol |
| SMILES | OC(Cc1cc(Cl)ccc1Cl)C1CCC1 |
| InChI | InChI=1S/C12H14Cl2O/c13-10-4-5-11(14)9(6-10)7-12(15)8-2-1-3-8/h4-6,8,12,15H,1-3,7H2 |
| InChIKey | HINJOACEKUJHLW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.15 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |