C14H19Cl2N — CID 112569673
2-cyclopentyl-3-(2,5-dichlorophenyl)propan-1-amine (PubChem CID 112569673) has the molecular formula C14H19Cl2N and a molecular weight of 272.22 g/mol. Its IUPAC name is 2-cyclopentyl-3-(2,5-dichlorophenyl)propan-1-amine.
| Compound Name | 2-cyclopentyl-3-(2,5-dichlorophenyl)propan-1-amine |
|---|---|
| PubChem CID | 112569673 |
| Molecular Formula | C14H19Cl2N |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 2-cyclopentyl-3-(2,5-dichlorophenyl)propan-1-amine |
| SMILES | NCC(Cc1cc(Cl)ccc1Cl)C1CCCC1 |
| InChI | InChI=1S/C14H19Cl2N/c15-13-5-6-14(16)11(8-13)7-12(9-17)10-3-1-2-4-10/h5-6,8,10,12H,1-4,7,9,17H2 |
| InChIKey | UMDKGFIUMCMGGB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |