C12H15ClFN — CID 176776827
3-(4-chloro-2-fluorophenyl)-2-cyclopropylpropan-1-amine (PubChem CID 176776827) has the molecular formula C12H15ClFN and a molecular weight of 227.71 g/mol. Its IUPAC name is 3-(4-chloro-2-fluorophenyl)-2-cyclopropylpropan-1-amine.
| Compound Name | 3-(4-chloro-2-fluorophenyl)-2-cyclopropylpropan-1-amine |
|---|---|
| PubChem CID | 176776827 |
| Molecular Formula | C12H15ClFN |
| Molecular Weight | 227.71 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 3-(4-chloro-2-fluorophenyl)-2-cyclopropylpropan-1-amine |
| SMILES | NCC(Cc1ccc(Cl)cc1F)C1CC1 |
| InChI | InChI=1S/C12H15ClFN/c13-11-4-3-9(12(14)6-11)5-10(7-15)8-1-2-8/h3-4,6,8,10H,1-2,5,7,15H2 |
| InChIKey | WKQZBFPRTSWRRR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.71 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |