C10H12ClFO2 — CID 103039553
1-(3-chloro-4-fluorophenyl)-3-methoxypropan-2-ol (PubChem CID 103039553) has the molecular formula C10H12ClFO2 and a molecular weight of 218.65 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-methoxypropan-2-ol.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-methoxypropan-2-ol |
|---|---|
| PubChem CID | 103039553 |
| Molecular Formula | C10H12ClFO2 |
| Molecular Weight | 218.65 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-methoxypropan-2-ol |
| SMILES | COCC(O)Cc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C10H12ClFO2/c1-14-6-8(13)4-7-2-3-10(12)9(11)5-7/h2-3,5,8,13H,4,6H2,1H3 |
| InChIKey | LFLMABRPSFSPHC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.65 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |