C12H17ClFNO2 — CID 103883811
1-[(3-chloro-4-fluorophenyl)methyl-methylamino]-3-methoxypropan-2-ol (PubChem CID 103883811) has the molecular formula C12H17ClFNO2 and a molecular weight of 261.72 g/mol. Its IUPAC name is 1-[(3-chloro-4-fluorophenyl)methyl-methylamino]-3-methoxypropan-2-ol.
| Compound Name | 1-[(3-chloro-4-fluorophenyl)methyl-methylamino]-3-methoxypropan-2-ol |
|---|---|
| PubChem CID | 103883811 |
| Molecular Formula | C12H17ClFNO2 |
| Molecular Weight | 261.72 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 1-[(3-chloro-4-fluorophenyl)methyl-methylamino]-3-methoxypropan-2-ol |
| SMILES | COCC(O)CN(C)Cc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C12H17ClFNO2/c1-15(7-10(16)8-17-2)6-9-3-4-12(14)11(13)5-9/h3-5,10,16H,6-8H2,1-2H3 |
| InChIKey | WACFWRNEUIHVGR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.72 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |