C12H17BrFNO2 — CID 62014573
1-[(5-bromo-2-fluorophenyl)methyl-methylamino]-3-methoxypropan-2-ol (PubChem CID 62014573) has the molecular formula C12H17BrFNO2 and a molecular weight of 306.18 g/mol. Its IUPAC name is 1-[(5-bromo-2-fluorophenyl)methyl-methylamino]-3-methoxypropan-2-ol.
| Compound Name | 1-[(5-bromo-2-fluorophenyl)methyl-methylamino]-3-methoxypropan-2-ol |
|---|---|
| PubChem CID | 62014573 |
| Molecular Formula | C12H17BrFNO2 |
| Molecular Weight | 306.18 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 1-[(5-bromo-2-fluorophenyl)methyl-methylamino]-3-methoxypropan-2-ol |
| SMILES | COCC(O)CN(C)Cc1cc(Br)ccc1F |
| InChI | InChI=1S/C12H17BrFNO2/c1-15(7-11(16)8-17-2)6-9-5-10(13)3-4-12(9)14/h3-5,11,16H,6-8H2,1-2H3 |
| InChIKey | ZCGFTEBWTJQCLB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.18 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |