C12H16BrFO2 — CID 62607672
1-(5-bromo-2-fluorophenyl)-3-propoxypropan-2-ol (PubChem CID 62607672) has the molecular formula C12H16BrFO2 and a molecular weight of 291.16 g/mol. Its IUPAC name is 1-(5-bromo-2-fluorophenyl)-3-propoxypropan-2-ol.
| Compound Name | 1-(5-bromo-2-fluorophenyl)-3-propoxypropan-2-ol |
|---|---|
| PubChem CID | 62607672 |
| Molecular Formula | C12H16BrFO2 |
| Molecular Weight | 291.16 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 1-(5-bromo-2-fluorophenyl)-3-propoxypropan-2-ol |
| SMILES | CCCOCC(O)Cc1cc(Br)ccc1F |
| InChI | InChI=1S/C12H16BrFO2/c1-2-5-16-8-11(15)7-9-6-10(13)3-4-12(9)14/h3-4,6,11,15H,2,5,7-8H2,1H3 |
| InChIKey | OPDNNHIHALSVEN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.16 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|