C13H19BrFNO3 — CID 106989579
1-[(5-bromo-2-fluorophenyl)methylamino]-3-(2-methoxyethoxy)propan-2-ol (PubChem CID 106989579) has the molecular formula C13H19BrFNO3 and a molecular weight of 336.20 g/mol. Its IUPAC name is 1-[(5-bromo-2-fluorophenyl)methylamino]-3-(2-methoxyethoxy)propan-2-ol.
| Compound Name | 1-[(5-bromo-2-fluorophenyl)methylamino]-3-(2-methoxyethoxy)propan-2-ol |
|---|---|
| PubChem CID | 106989579 |
| Molecular Formula | C13H19BrFNO3 |
| Molecular Weight | 336.20 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 1-[(5-bromo-2-fluorophenyl)methylamino]-3-(2-methoxyethoxy)propan-2-ol |
| SMILES | COCCOCC(O)CNCc1cc(Br)ccc1F |
| InChI | InChI=1S/C13H19BrFNO3/c1-18-4-5-19-9-12(17)8-16-7-10-6-11(14)2-3-13(10)15/h2-3,6,12,16-17H,4-5,7-9H2,1H3 |
| InChIKey | XAYCRGJIYOWIBC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.20 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|