C15H23F2NO3 — CID 63794811
1-[(2,5-difluorophenyl)methylamino]-3-(2-propan-2-yloxyethoxy)propan-2-ol (PubChem CID 63794811) has the molecular formula C15H23F2NO3 and a molecular weight of 303.35 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methylamino]-3-(2-propan-2-yloxyethoxy)propan-2-ol.
| Compound Name | 1-[(2,5-difluorophenyl)methylamino]-3-(2-propan-2-yloxyethoxy)propan-2-ol |
|---|---|
| PubChem CID | 63794811 |
| Molecular Formula | C15H23F2NO3 |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methylamino]-3-(2-propan-2-yloxyethoxy)propan-2-ol |
| SMILES | CC(C)OCCOCC(O)CNCc1cc(F)ccc1F |
| InChI | InChI=1S/C15H23F2NO3/c1-11(2)21-6-5-20-10-14(19)9-18-8-12-7-13(16)3-4-15(12)17/h3-4,7,11,14,18-19H,5-6,8-10H2,1-2H3 |
| InChIKey | UQELFQCKPXDULB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|