C14H27N3O3 — CID 106044600
1-[(1,5-dimethylpyrazol-4-yl)methylamino]-3-(2-propan-2-yloxyethoxy)propan-2-ol (PubChem CID 106044600) has the molecular formula C14H27N3O3 and a molecular weight of 285.39 g/mol. Its IUPAC name is 1-[(1,5-dimethylpyrazol-4-yl)methylamino]-3-(2-propan-2-yloxyethoxy)propan-2-ol.
| Compound Name | 1-[(1,5-dimethylpyrazol-4-yl)methylamino]-3-(2-propan-2-yloxyethoxy)propan-2-ol |
|---|---|
| PubChem CID | 106044600 |
| Molecular Formula | C14H27N3O3 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | 1-[(1,5-dimethylpyrazol-4-yl)methylamino]-3-(2-propan-2-yloxyethoxy)propan-2-ol |
| SMILES | Cc1c(CNCC(O)COCCOC(C)C)cnn1C |
| InChI | InChI=1S/C14H27N3O3/c1-11(2)20-6-5-19-10-14(18)9-15-7-13-8-16-17(4)12(13)3/h8,11,14-15,18H,5-7,9-10H2,1-4H3 |
| InChIKey | QVARABCHBJKMMZ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|