C13H22BrNO3S — CID 60970520
1-[(4-bromothiophen-2-yl)methylamino]-3-(2-propan-2-yloxyethoxy)propan-2-ol (PubChem CID 60970520) has the molecular formula C13H22BrNO3S and a molecular weight of 352.29 g/mol. Its IUPAC name is 1-[(4-bromothiophen-2-yl)methylamino]-3-(2-propan-2-yloxyethoxy)propan-2-ol.
| Compound Name | 1-[(4-bromothiophen-2-yl)methylamino]-3-(2-propan-2-yloxyethoxy)propan-2-ol |
|---|---|
| PubChem CID | 60970520 |
| Molecular Formula | C13H22BrNO3S |
| Molecular Weight | 352.29 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 1-[(4-bromothiophen-2-yl)methylamino]-3-(2-propan-2-yloxyethoxy)propan-2-ol |
| SMILES | CC(C)OCCOCC(O)CNCc1cc(Br)cs1 |
| InChI | InChI=1S/C13H22BrNO3S/c1-10(2)18-4-3-17-8-12(16)6-15-7-13-5-11(14)9-19-13/h5,9-10,12,15-16H,3-4,6-8H2,1-2H3 |
| InChIKey | QJUCLGWYNXSJGU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|