C14H21FINO3 — CID 79769591
1-(4-fluoro-2-iodoanilino)-3-(2-propan-2-yloxyethoxy)propan-2-ol (PubChem CID 79769591) has the molecular formula C14H21FINO3 and a molecular weight of 397.23 g/mol. Its IUPAC name is 1-(4-fluoro-2-iodoanilino)-3-(2-propan-2-yloxyethoxy)propan-2-ol.
| Compound Name | 1-(4-fluoro-2-iodoanilino)-3-(2-propan-2-yloxyethoxy)propan-2-ol |
|---|---|
| PubChem CID | 79769591 |
| Molecular Formula | C14H21FINO3 |
| Molecular Weight | 397.23 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | 1-(4-fluoro-2-iodoanilino)-3-(2-propan-2-yloxyethoxy)propan-2-ol |
| SMILES | CC(C)OCCOCC(O)CNc1ccc(F)cc1I |
| InChI | InChI=1S/C14H21FINO3/c1-10(2)20-6-5-19-9-12(18)8-17-14-4-3-11(15)7-13(14)16/h3-4,7,10,12,17-18H,5-6,8-9H2,1-2H3 |
| InChIKey | XUSJXCWVPSSQNM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.23 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|