C14H20Cl3NO3 — CID 60896346
1-(2-propan-2-yloxyethoxy)-3-(2,4,5-trichloroanilino)propan-2-ol (PubChem CID 60896346) has the molecular formula C14H20Cl3NO3 and a molecular weight of 356.68 g/mol. Its IUPAC name is 1-(2-propan-2-yloxyethoxy)-3-(2,4,5-trichloroanilino)propan-2-ol.
| Compound Name | 1-(2-propan-2-yloxyethoxy)-3-(2,4,5-trichloroanilino)propan-2-ol |
|---|---|
| PubChem CID | 60896346 |
| Molecular Formula | C14H20Cl3NO3 |
| Molecular Weight | 356.68 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | 1-(2-propan-2-yloxyethoxy)-3-(2,4,5-trichloroanilino)propan-2-ol |
| SMILES | CC(C)OCCOCC(O)CNc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H20Cl3NO3/c1-9(2)21-4-3-20-8-10(19)7-18-14-6-12(16)11(15)5-13(14)17/h5-6,9-10,18-19H,3-4,7-8H2,1-2H3 |
| InChIKey | MRMNJUIJGNMQAJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.68 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|