C20H26BrNO4 — CID 46798100
1-[(5-bromo-2-methoxyphenyl)methyl-methylamino]-3-(4-ethoxyphenoxy)propan-2-ol (PubChem CID 46798100) has the molecular formula C20H26BrNO4 and a molecular weight of 424.34 g/mol. Its IUPAC name is 1-[(5-bromo-2-methoxyphenyl)methyl-methylamino]-3-(4-ethoxyphenoxy)propan-2-ol.
| Compound Name | 1-[(5-bromo-2-methoxyphenyl)methyl-methylamino]-3-(4-ethoxyphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 46798100 |
| Molecular Formula | C20H26BrNO4 |
| Molecular Weight | 424.34 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | 1-[(5-bromo-2-methoxyphenyl)methyl-methylamino]-3-(4-ethoxyphenoxy)propan-2-ol |
| SMILES | CCOc1ccc(OCC(O)CN(C)Cc2cc(Br)ccc2OC)cc1 |
| InChI | InChI=1S/C20H26BrNO4/c1-4-25-18-6-8-19(9-7-18)26-14-17(23)13-22(2)12-15-11-16(21)5-10-20(15)24-3/h5-11,17,23H,4,12-14H2,1-3H3 |
| InChIKey | YZICUKDNGHHNKK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |