C13H20FNO3 — CID 100857627
(2S)-1-[[(2S)-2-(4-fluorophenyl)-2-hydroxyethyl]-methylamino]-3-methoxypropan-2-ol (PubChem CID 100857627) has the molecular formula C13H20FNO3 and a molecular weight of 257.31 g/mol. Its IUPAC name is (2S)-1-[[(2S)-2-(4-fluorophenyl)-2-hydroxyethyl]-methylamino]-3-methoxypropan-2-ol.
| Compound Name | (2S)-1-[[(2S)-2-(4-fluorophenyl)-2-hydroxyethyl]-methylamino]-3-methoxypropan-2-ol |
|---|---|
| PubChem CID | 100857627 |
| Molecular Formula | C13H20FNO3 |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | (2S)-1-[[(2S)-2-(4-fluorophenyl)-2-hydroxyethyl]-methylamino]-3-methoxypropan-2-ol |
| SMILES | COC[C@@H](O)CN(C)C[C@@H](O)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H20FNO3/c1-15(7-12(16)9-18-2)8-13(17)10-3-5-11(14)6-4-10/h3-6,12-13,16-17H,7-9H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | FWXKOSUEYPFCKF-QWHCGFSZSA-N |
| XLogP | 0.80 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |